C16H25F2N3O2 — CID 109495047
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-methylpropyl)guanidine (PubChem CID 109495047) has the molecular formula C16H25F2N3O2 and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-methylpropyl)guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 109495047 |
| Molecular Formula | C16H25F2N3O2 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-methylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)C)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H25F2N3O2/c1-4-19-16(20-9-11(2)3)21-10-14(22)12-5-7-13(8-6-12)23-15(17)18/h5-8,11,14-15,22H,4,9-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | OLSGUSSPCUQPSC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|