C18H29F2N3O2 — CID 109494947
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine (PubChem CID 109494947) has the molecular formula C18H29F2N3O2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine |
|---|---|
| PubChem CID | 109494947 |
| Molecular Formula | C18H29F2N3O2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(CC)CC)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H29F2N3O2/c1-4-13(5-2)11-22-18(21-6-3)23-12-16(24)14-7-9-15(10-8-14)25-17(19)20/h7-10,13,16-17,24H,4-6,11-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | XZNAQXUBADUGOS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|