C19H30F2N4O3 — CID 109495485
3-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide (PubChem CID 109495485) has the molecular formula C19H30F2N4O3 and a molecular weight of 400.47 g/mol. Its IUPAC name is 3-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | 3-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109495485 |
| Molecular Formula | C19H30F2N4O3 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCNC(=O)C(C)(C)C/N=C(\NCC)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H30F2N4O3/c1-5-22-16(27)19(3,4)12-25-18(23-6-2)24-11-15(26)13-7-9-14(10-8-13)28-17(20)21/h7-10,15,17,26H,5-6,11-12H2,1-4H3,(H,22,27)(H2,23,24,25) |
| InChIKey | LIAVKBMSAWZXOL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|