C19H29F2N3O3 — CID 109495755
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine (PubChem CID 109495755) has the molecular formula C19H29F2N3O3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 109495755 |
| Molecular Formula | C19H29F2N3O3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCOC)CC1)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H29F2N3O3/c1-3-22-18(24-13-19(8-9-19)10-11-26-2)23-12-16(25)14-4-6-15(7-5-14)27-17(20)21/h4-7,16-17,25H,3,8-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | UZOAVLHKOOUKFO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|