C18H27F2N3O4 — CID 109495315
tert-butyl 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]acetate (PubChem CID 109495315) has the molecular formula C18H27F2N3O4 and a molecular weight of 387.43 g/mol. Its IUPAC name is tert-butyl 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]acetate |
|---|---|
| PubChem CID | 109495315 |
| Molecular Formula | C18H27F2N3O4 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | tert-butyl 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]acetate |
| SMILES | CCN/C(=N\CC(=O)OC(C)(C)C)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H27F2N3O4/c1-5-21-17(23-11-15(25)27-18(2,3)4)22-10-14(24)12-6-8-13(9-7-12)26-16(19)20/h6-9,14,16,24H,5,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | GVUVGYXUEJRUCB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|