C22H29F2IN4O3 — CID 109495672
2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide (PubChem CID 109495672) has the molecular formula C22H29F2IN4O3 and a molecular weight of 562.40 g/mol. Its IUPAC name is 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109495672 |
| Molecular Formula | C22H29F2IN4O3 |
| Molecular Weight | 562.40 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(CC)c1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C22H28F2N4O3.HI/c1-3-15-6-5-7-17(12-15)28-20(30)14-27-22(25-4-2)26-13-19(29)16-8-10-18(11-9-16)31-21(23)24;/h5-12,19,21,29H,3-4,13-14H2,1-2H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | IMSRSVOBUCHRNM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|