C17H24F5IN4O3 — CID 109494948
2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 109494948) has the molecular formula C17H24F5IN4O3 and a molecular weight of 554.30 g/mol. Its IUPAC name is 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109494948 |
| Molecular Formula | C17H24F5IN4O3 |
| Molecular Weight | 554.30 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C17H23F5N4O3.HI/c1-3-23-16(25-9-14(28)26(2)10-17(20,21)22)24-8-13(27)11-4-6-12(7-5-11)29-15(18)19;/h4-7,13,15,27H,3,8-10H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | WDLPVEPESUZYAF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|