C20H34F2N4O3 — CID 109494635
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[4-(dimethylamino)-2-ethoxybutyl]-3-ethylguanidine (PubChem CID 109494635) has the molecular formula C20H34F2N4O3 and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[4-(dimethylamino)-2-ethoxybutyl]-3-ethylguanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[4-(dimethylamino)-2-ethoxybutyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109494635 |
| Molecular Formula | C20H34F2N4O3 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[4-(dimethylamino)-2-ethoxybutyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(CCN(C)C)OCC)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H34F2N4O3/c1-5-23-20(24-13-17(28-6-2)11-12-26(3)4)25-14-18(27)15-7-9-16(10-8-15)29-19(21)22/h7-10,17-19,27H,5-6,11-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | WLJTUBKFAJHWMW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|