C22H29F2N3O3 — CID 109494557
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(2-methoxyphenyl)propyl]guanidine (PubChem CID 109494557) has the molecular formula C22H29F2N3O3 and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(2-methoxyphenyl)propyl]guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(2-methoxyphenyl)propyl]guanidine |
|---|---|
| PubChem CID | 109494557 |
| Molecular Formula | C22H29F2N3O3 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(2-methoxyphenyl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccccc1OC)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H29F2N3O3/c1-4-25-22(26-13-15(2)18-7-5-6-8-20(18)29-3)27-14-19(28)16-9-11-17(12-10-16)30-21(23)24/h5-12,15,19,21,28H,4,13-14H2,1-3H3,(H2,25,26,27) |
| InChIKey | OXACTYYYZGEETR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|