C21H27F2N3O4 — CID 109494937
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[(2,3-dimethoxyphenyl)methyl]-3-ethylguanidine (PubChem CID 109494937) has the molecular formula C21H27F2N3O4 and a molecular weight of 423.46 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[(2,3-dimethoxyphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[(2,3-dimethoxyphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109494937 |
| Molecular Formula | C21H27F2N3O4 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-[(2,3-dimethoxyphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H27F2N3O4/c1-4-24-21(25-12-15-6-5-7-18(28-2)19(15)29-3)26-13-17(27)14-8-10-16(11-9-14)30-20(22)23/h5-11,17,20,27H,4,12-13H2,1-3H3,(H2,24,25,26) |
| InChIKey | UIAJAVPKQKGWJJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|