C25H37IN4O3 — CID 111291442
2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111291442) has the molecular formula C25H37IN4O3 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111291442 |
| Molecular Formula | C25H37IN4O3 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC)NCC(c1ccc(OC)cc1)N1CCCC1.I |
| InChI | InChI=1S/C25H36N4O3.HI/c1-5-26-25(27-17-20-9-8-10-23(31-3)24(20)32-4)28-18-22(29-15-6-7-16-29)19-11-13-21(30-2)14-12-19;/h8-14,22H,5-7,15-18H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | PKGLVWRUPLHKDJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|