C21H36F2IN5O2 — CID 109495648
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 109495648) has the molecular formula C21H36F2IN5O2 and a molecular weight of 555.45 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495648 |
| Molecular Formula | C21H36F2IN5O2 |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCN(CC)CC1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H35F2N5O2.HI/c1-4-24-21(25-14-16(3)28-12-10-27(5-2)11-13-28)26-15-19(29)17-6-8-18(9-7-17)30-20(22)23;/h6-9,16,19-20,29H,4-5,10-15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | UXYCZXRLYBHQAJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|