C22H38F2IN5O2 — CID 109495510
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 109495510) has the molecular formula C22H38F2IN5O2 and a molecular weight of 569.48 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495510 |
| Molecular Formula | C22H38F2IN5O2 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCCCN1CCN(CC)CC1.I |
| InChI | InChI=1S/C22H37F2N5O2.HI/c1-3-25-22(26-11-5-6-12-29-15-13-28(4-2)14-16-29)27-17-20(30)18-7-9-19(10-8-18)31-21(23)24;/h7-10,20-21,30H,3-6,11-17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | PUVSUMONGGZUJK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|