C21H34F2N4O3 — CID 109494925
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethylguanidine (PubChem CID 109494925) has the molecular formula C21H34F2N4O3 and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethylguanidine.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109494925 |
| Molecular Formula | C21H34F2N4O3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H34F2N4O3/c1-4-24-21(25-10-5-11-27-13-15(2)29-16(3)14-27)26-12-19(28)17-6-8-18(9-7-17)30-20(22)23/h6-9,15-16,19-20,28H,4-5,10-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | STRGXBGKQSPZFM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|