C21H29F2IN4O2 — CID 109495658
1-(3-anilinopropyl)-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109495658) has the molecular formula C21H29F2IN4O2 and a molecular weight of 534.39 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(3-anilinopropyl)-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109495658 |
| Molecular Formula | C21H29F2IN4O2 |
| Molecular Weight | 534.39 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-(3-anilinopropyl)-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCCNc1ccccc1.I |
| InChI | InChI=1S/C21H28F2N4O2.HI/c1-2-24-21(26-14-6-13-25-17-7-4-3-5-8-17)27-15-19(28)16-9-11-18(12-10-16)29-20(22)23;/h3-5,7-12,19-20,25,28H,2,6,13-15H2,1H3,(H2,24,26,27);1H |
| InChIKey | XHQMVEHHCMEISL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|