C20H26F2IN3O4S — CID 109495054
1-[2-(benzenesulfonyl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109495054) has the molecular formula C20H26F2IN3O4S and a molecular weight of 569.41 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109495054 |
| Molecular Formula | C20H26F2IN3O4S |
| Molecular Weight | 569.41 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C20H25F2N3O4S.HI/c1-2-23-20(24-12-13-30(27,28)17-6-4-3-5-7-17)25-14-18(26)15-8-10-16(11-9-15)29-19(21)22;/h3-11,18-19,26H,2,12-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | ZQBGDVWCJFAVLZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|