C21H26F2IN5O2 — CID 109494884
1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109494884) has the molecular formula C21H26F2IN5O2 and a molecular weight of 545.37 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109494884 |
| Molecular Formula | C21H26F2IN5O2 |
| Molecular Weight | 545.37 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C21H25F2N5O2.HI/c1-2-24-21(25-12-11-19-27-16-5-3-4-6-17(16)28-19)26-13-18(29)14-7-9-15(10-8-14)30-20(22)23;/h3-10,18,20,29H,2,11-13H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | OBJLOPXBABLIEF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|