C15H20F3N5 — CID 109472421
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472421) has the molecular formula C15H20F3N5 and a molecular weight of 327.35 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472421 |
| Molecular Formula | C15H20F3N5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H20F3N5/c1-2-19-14(21-10-8-15(16,17)18)20-9-7-13-22-11-5-3-4-6-12(11)23-13/h3-6H,2,7-10H2,1H3,(H,22,23)(H2,19,20,21) |
| InChIKey | UTNOFOUNLQZOBG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|