C19H24F3IN6S — CID 111689727
2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689727) has the molecular formula C19H24F3IN6S and a molecular weight of 552.41 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689727 |
| Molecular Formula | C19H24F3IN6S |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C19H23F3N6S.HI/c1-2-23-18(25-11-9-17-28-15(12-29-17)19(20,21)22)24-10-5-8-16-26-13-6-3-4-7-14(13)27-16;/h3-4,6-7,12H,2,5,8-11H2,1H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | ULVCFWUVUDWDDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|