C18H30IN5 — CID 110978332
2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110978332) has the molecular formula C18H30IN5 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110978332 |
| Molecular Formula | C18H30IN5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NCCC(C)C.I |
| InChI | InChI=1S/C18H29N5.HI/c1-4-19-18(21-13-11-14(2)3)20-12-7-10-17-22-15-8-5-6-9-16(15)23-17;/h5-6,8-9,14H,4,7,10-13H2,1-3H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | LAAYLJRZBNAVEP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|