C20H33N5O — CID 111239771
2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-butoxypropyl)-3-ethylguanidine (PubChem CID 111239771) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-butoxypropyl)-3-ethylguanidine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-butoxypropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111239771 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-butoxypropyl)-3-ethylguanidine |
| SMILES | CCCCOCCCN/C(=N/CCCc1nc2ccccc2[nH]1)NCC |
| InChI | InChI=1S/C20H33N5O/c1-3-5-15-26-16-9-14-23-20(21-4-2)22-13-8-12-19-24-17-10-6-7-11-18(17)25-19/h6-7,10-11H,3-5,8-9,12-16H2,1-2H3,(H,24,25)(H2,21,22,23) |
| InChIKey | YVKIGIBRMOHIGR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|