C14H21N5 — CID 110914745
2-[2-(1H-benzimidazol-2-yl)ethyl]-1,3-diethylguanidine (PubChem CID 110914745) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)ethyl]-1,3-diethylguanidine.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 110914745 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCCc1nc2ccccc2[nH]1)NCC |
| InChI | InChI=1S/C14H21N5/c1-3-15-14(16-4-2)17-10-9-13-18-11-7-5-6-8-12(11)19-13/h5-8H,3-4,9-10H2,1-2H3,(H,18,19)(H2,15,16,17) |
| InChIKey | ACKOYCHLNWCVSW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|