C19H30N6O — CID 111942099
3-[[[2-(1H-benzimidazol-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide (PubChem CID 111942099) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[[[2-(1H-benzimidazol-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[[2-(1H-benzimidazol-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111942099 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 3-[[[2-(1H-benzimidazol-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H30N6O/c1-4-20-19(22-14-12-18(26)25(5-2)6-3)21-13-11-17-23-15-9-7-8-10-16(15)24-17/h7-10H,4-6,11-14H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | INKNMHWMYDUSEY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|