C20H30IN7 — CID 111278670
1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide (PubChem CID 111278670) has the molecular formula C20H30IN7 and a molecular weight of 495.41 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111278670 |
| Molecular Formula | C20H30IN7 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C20H29N7.HI/c1-4-21-20(22-11-7-13-27-16(3)14-15(2)26-27)23-12-10-19-24-17-8-5-6-9-18(17)25-19;/h5-6,8-9,14H,4,7,10-13H2,1-3H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | LMLMKRIFGLQVIK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|