C19H28N8O — CID 111764915
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine (PubChem CID 111764915) has the molecular formula C19H28N8O and a molecular weight of 384.49 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111764915 |
| Molecular Formula | C19H28N8O |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C19H28N8O/c1-4-20-19(21-9-6-11-27-15(3)13-14(2)26-27)22-10-8-17-23-18(25-24-17)16-7-5-12-28-16/h5,7,12-13H,4,6,8-11H2,1-3H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | DTAIBZGMPZYILO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|