C19H33N7 — CID 111278687
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111278687) has the molecular formula C19H33N7 and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111278687 |
| Molecular Formula | C19H33N7 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C19H33N7/c1-7-20-19(21-10-8-12-26-15(3)13-14(2)23-26)22-11-9-18-16(4)24-25(6)17(18)5/h13H,7-12H2,1-6H3,(H2,20,21,22) |
| InChIKey | BDFNYVCHBGWONW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|