C17H33N5 — CID 111161437
1-ethyl-2-hexyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111161437) has the molecular formula C17H33N5 and a molecular weight of 307.49 g/mol. Its IUPAC name is 1-ethyl-2-hexyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-hexyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111161437 |
| Molecular Formula | C17H33N5 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | 1-ethyl-2-hexyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCCCCC/N=C(\NCC)NCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H33N5/c1-6-8-9-10-12-19-17(18-7-2)20-13-11-16-14(3)21-22(5)15(16)4/h6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | CRJKCLISOSYLIL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|