C18H29N5S — CID 111956761
1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111956761) has the molecular formula C18H29N5S and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111956761 |
| Molecular Formula | C18H29N5S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CC)s1)NCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C18H29N5S/c1-6-15-8-9-16(24-15)12-21-18(19-7-2)20-11-10-17-13(3)22-23(5)14(17)4/h8-9H,6-7,10-12H2,1-5H3,(H2,19,20,21) |
| InChIKey | IAVQQUSACXJORI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|