C16H30N4S — CID 111957911
1-[2-(diethylamino)ethyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine (PubChem CID 111957911) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111957911 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CC)s1)NCCN(CC)CC |
| InChI | InChI=1S/C16H30N4S/c1-5-14-9-10-15(21-14)13-19-16(17-6-2)18-11-12-20(7-3)8-4/h9-10H,5-8,11-13H2,1-4H3,(H2,17,18,19) |
| InChIKey | WFDYNJGILJHRNP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|