C14H27IN4O2S2 — CID 111957474
1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]guanidine;hydroiodide (PubChem CID 111957474) has the molecular formula C14H27IN4O2S2 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111957474 |
| Molecular Formula | C14H27IN4O2S2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1-ethyl-2-[(5-ethylthiophen-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CC)s1)NCCCNS(C)(=O)=O.I |
| InChI | InChI=1S/C14H26N4O2S2.HI/c1-4-12-7-8-13(21-12)11-17-14(15-5-2)16-9-6-10-18-22(3,19)20;/h7-8,18H,4-6,9-11H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | XMTCUOUYVDQJBN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|