C19H37N5 — CID 111127889
1-ethyl-2-(2-ethylhexyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111127889) has the molecular formula C19H37N5 and a molecular weight of 335.54 g/mol. Its IUPAC name is 1-ethyl-2-(2-ethylhexyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-ethylhexyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111127889 |
| Molecular Formula | C19H37N5 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 1-ethyl-2-(2-ethylhexyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCCCC(CC)C/N=C(\NCC)NCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C19H37N5/c1-7-10-11-17(8-2)14-22-19(20-9-3)21-13-12-18-15(4)23-24(6)16(18)5/h17H,7-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | VBLPHBWYYWDKCI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|