C21H40N6O — CID 111935079
1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111935079) has the molecular formula C21H40N6O and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111935079 |
| Molecular Formula | C21H40N6O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(CC(C)C)N1CCOCC1)NCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C21H40N6O/c1-7-22-21(23-9-8-20-17(4)25-26(6)18(20)5)24-15-19(14-16(2)3)27-10-12-28-13-11-27/h16,19H,7-15H2,1-6H3,(H2,22,23,24) |
| InChIKey | QBTQEMKKQZSGPS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|