C19H40IN5O2 — CID 111188064
1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111188064) has the molecular formula C19H40IN5O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111188064 |
| Molecular Formula | C19H40IN5O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)N1CCOCC1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C19H39N5O2.HI/c1-4-20-19(21-5-6-23-7-11-25-12-8-23)22-16-18(15-17(2)3)24-9-13-26-14-10-24;/h17-18H,4-16H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | PJZYAFBBOMLSAK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|