C18H37IN4OS — CID 111935886
1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111935886) has the molecular formula C18H37IN4OS and a molecular weight of 484.49 g/mol. Its IUPAC name is 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111935886 |
| Molecular Formula | C18H37IN4OS |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C=CCSCCN/C(=N/CC(CC(C)C)N1CCOCC1)NCC.I |
| InChI | InChI=1S/C18H36N4OS.HI/c1-5-12-24-13-7-20-18(19-6-2)21-15-17(14-16(3)4)22-8-10-23-11-9-22;/h5,16-17H,1,6-15H2,2-4H3,(H2,19,20,21);1H |
| InChIKey | MTHRXYQBHZVFOG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|