C16H32N4OS — CID 111315202
1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine (PubChem CID 111315202) has the molecular formula C16H32N4OS and a molecular weight of 328.53 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111315202 |
| Molecular Formula | C16H32N4OS |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine |
| SMILES | C=CCSCCN/C(=N/CC(C)(C)N1CCOCC1)NCC |
| InChI | InChI=1S/C16H32N4OS/c1-5-12-22-13-7-18-15(17-6-2)19-14-16(3,4)20-8-10-21-11-9-20/h5H,1,6-14H2,2-4H3,(H2,17,18,19) |
| InChIKey | PEHZPLMANQWWEF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|