C15H34IN5O3S — CID 111935782
1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111935782) has the molecular formula C15H34IN5O3S and a molecular weight of 491.44 g/mol. Its IUPAC name is 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111935782 |
| Molecular Formula | C15H34IN5O3S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)N1CCOCC1)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C15H33N5O3S.HI/c1-4-17-15(18-5-10-24(16,21)22)19-12-14(11-13(2)3)20-6-8-23-9-7-20;/h13-14H,4-12H2,1-3H3,(H2,16,21,22)(H2,17,18,19);1H |
| InChIKey | CHHWTRHTGQBGRB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|