C16H35N5O3S — CID 111936761
1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine (PubChem CID 111936761) has the molecular formula C16H35N5O3S and a molecular weight of 377.56 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111936761 |
| Molecular Formula | C16H35N5O3S |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C16H35N5O3S/c1-4-14(5-2)15(21-8-10-24-11-9-21)13-20-16(18-6-3)19-7-12-25(17,22)23/h14-15H,4-13H2,1-3H3,(H2,17,22,23)(H2,18,19,20) |
| InChIKey | ADCIVWHSHZVZIN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|