C22H45N5O — CID 111936689
1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-pyrrolidin-1-ylbutyl)guanidine (PubChem CID 111936689) has the molecular formula C22H45N5O and a molecular weight of 395.64 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-pyrrolidin-1-ylbutyl)guanidine.
| Compound Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-pyrrolidin-1-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111936689 |
| Molecular Formula | C22H45N5O |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.36 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(4-pyrrolidin-1-ylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCCCN1CCCC1 |
| InChI | InChI=1S/C22H45N5O/c1-4-20(5-2)21(27-15-17-28-18-16-27)19-25-22(23-6-3)24-11-7-8-12-26-13-9-10-14-26/h20-21H,4-19H2,1-3H3,(H2,23,24,25) |
| InChIKey | NZMYBRKWYOWVOA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|