C17H37IN4OS — CID 111344010
1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111344010) has the molecular formula C17H37IN4OS and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111344010 |
| Molecular Formula | C17H37IN4OS |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCSC.I |
| InChI | InChI=1S/C17H36N4OS.HI/c1-5-15(6-2)16(21-9-11-22-12-10-21)14-20-17(18-7-3)19-8-13-23-4;/h15-16H,5-14H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | FSXKLFOUWAPUNE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|