C22H38IN7O — CID 111936232
1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111936232) has the molecular formula C22H38IN7O and a molecular weight of 543.50 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111936232 |
| Molecular Formula | C22H38IN7O |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C22H37N7O.HI/c1-4-18(5-2)19(28-13-15-30-16-14-28)17-25-22(23-6-3)24-11-10-21-27-26-20-9-7-8-12-29(20)21;/h7-9,12,18-19H,4-6,10-11,13-17H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | AMUPVBPAKIQSDX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|