C21H37N5O3 — CID 111936667
N-[2-[[N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111936667) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111936667 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C21H37N5O3/c1-4-17(5-2)18(26-11-14-28-15-12-26)16-25-21(22-6-3)24-10-9-23-20(27)19-8-7-13-29-19/h7-8,13,17-18H,4-6,9-12,14-16H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | OYTGOUACVGJZJH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|