C23H33N5O4 — CID 111309666
N-[2-[[N-ethyl-N'-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111309666) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111309666 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCOCC1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C23H33N5O4/c1-3-24-23(26-11-10-25-22(29)21-5-4-14-32-21)27-17-20(28-12-15-31-16-13-28)18-6-8-19(30-2)9-7-18/h4-9,14,20H,3,10-13,15-17H2,1-2H3,(H,25,29)(H2,24,26,27) |
| InChIKey | WHRIAJCGHXTLST-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|