C20H37IN6O2S — CID 111935426
N-[2-[[N-ethyl-N'-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111935426) has the molecular formula C20H37IN6O2S and a molecular weight of 552.53 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111935426 |
| Molecular Formula | C20H37IN6O2S |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)N1CCOCC1)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C20H36N6O2S.HI/c1-5-21-20(23-7-6-22-19(27)18-16(4)25-14-29-18)24-13-17(12-15(2)3)26-8-10-28-11-9-26;/h14-15,17H,5-13H2,1-4H3,(H,22,27)(H2,21,23,24);1H |
| InChIKey | NKVIUDXDSQSCTC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|