C17H30N6O2S — CID 111021855
N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111021855) has the molecular formula C17H30N6O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111021855 |
| Molecular Formula | C17H30N6O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C17H30N6O2S/c1-4-18-17(21-11-13(2)23-7-9-25-10-8-23)20-6-5-19-16(24)15-14(3)22-12-26-15/h12-13H,4-11H2,1-3H3,(H,19,24)(H2,18,20,21) |
| InChIKey | SRZCCSORXJCTEP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|