C20H33N5O3 — CID 111020931
N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methoxybenzamide (PubChem CID 111020931) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 111020931 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]-4-methoxybenzamide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H33N5O3/c1-4-21-20(24-15-16(2)25-11-13-28-14-12-25)23-10-9-22-19(26)17-5-7-18(27-3)8-6-17/h5-8,16H,4,9-15H2,1-3H3,(H,22,26)(H2,21,23,24) |
| InChIKey | IVAWWFPUSJSSMQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|