C18H34IN5O2S — CID 111714512
N-[2-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111714512) has the molecular formula C18H34IN5O2S and a molecular weight of 511.47 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111714512 |
| Molecular Formula | C18H34IN5O2S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C18H33N5O2S.HI/c1-5-19-18(22-11-15(6-9-24)10-13(2)3)21-8-7-20-17(25)16-14(4)23-12-26-16;/h12-13,15,24H,5-11H2,1-4H3,(H,20,25)(H2,19,21,22);1H |
| InChIKey | LPAGHCKXWYCGNW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|