C18H33N5O2S — CID 111715886
N-[2-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111715886) has the molecular formula C18H33N5O2S and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[2-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111715886 |
| Molecular Formula | C18H33N5O2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-[2-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C18H33N5O2S/c1-5-18(6-2,8-11-24)12-22-17(19-7-3)21-10-9-20-16(25)15-14(4)23-13-26-15/h13,24H,5-12H2,1-4H3,(H,20,25)(H2,19,21,22) |
| InChIKey | DPQCXNDQSGIKMU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|