C14H22N8OS — CID 111705245
N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111705245) has the molecular formula C14H22N8OS and a molecular weight of 350.45 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111705245 |
| Molecular Formula | C14H22N8OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C14H22N8OS/c1-4-15-14(18-7-11-19-8-21-22(11)3)17-6-5-16-13(23)12-10(2)20-9-24-12/h8-9H,4-7H2,1-3H3,(H,16,23)(H2,15,17,18) |
| InChIKey | DQIXGUASSITKIV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|