C17H25FIN7O — CID 111707862
N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111707862) has the molecular formula C17H25FIN7O and a molecular weight of 489.34 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111707862 |
| Molecular Formula | C17H25FIN7O |
| Molecular Weight | 489.34 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCNC(=O)c1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C17H24FN7O.HI/c1-4-19-17(22-10-15-23-11-24-25(15)3)21-8-7-20-16(26)13-6-5-12(2)14(18)9-13;/h5-6,9,11H,4,7-8,10H2,1-3H3,(H,20,26)(H2,19,21,22);1H |
| InChIKey | YHEBJZXABNBFRO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|