C23H31FIN5O2 — CID 111872956
N-[2-[[N'-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111872956) has the molecular formula C23H31FIN5O2 and a molecular weight of 555.44 g/mol. Its IUPAC name is N-[2-[[N'-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N'-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111872956 |
| Molecular Formula | C23H31FIN5O2 |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | N-[2-[[N'-[[4-(dimethylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCCNC(=O)c1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C23H30FN5O2.HI/c1-5-25-23(28-15-17-7-10-18(11-8-17)22(31)29(3)4)27-13-12-26-21(30)19-9-6-16(2)20(24)14-19;/h6-11,14H,5,12-13,15H2,1-4H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | UWWYWRBVQVCRCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|